C17H16N4O4 — CID 87015415
5-[(2-methoxyphenoxy)methyl]-N'-pyrimidin-2-ylfuran-2-carbohydrazide (PubChem CID 87015415) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 5-[(2-methoxyphenoxy)methyl]-N'-pyrimidin-2-ylfuran-2-carbohydrazide.
| Compound Name | 5-[(2-methoxyphenoxy)methyl]-N'-pyrimidin-2-ylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 87015415 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 5-[(2-methoxyphenoxy)methyl]-N'-pyrimidin-2-ylfuran-2-carbohydrazide |
| SMILES | COc1ccccc1OCc1ccc(C(=O)NNc2ncccn2)o1 |
| InChI | InChI=1S/C17H16N4O4/c1-23-13-5-2-3-6-14(13)24-11-12-7-8-15(25-12)16(22)20-21-17-18-9-4-10-19-17/h2-10H,11H2,1H3,(H,20,22)(H,18,19,21) |
| InChIKey | FGDAWFDKUDJUPU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 98.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|