C19H23NO6 — CID 55788987
propan-2-yl 3-[[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]amino]propanoate (PubChem CID 55788987) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is propan-2-yl 3-[[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]amino]propanoate.
| Compound Name | propan-2-yl 3-[[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 55788987 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | propan-2-yl 3-[[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]amino]propanoate |
| SMILES | COc1ccccc1OCc1ccc(C(=O)NCCC(=O)OC(C)C)o1 |
| InChI | InChI=1S/C19H23NO6/c1-13(2)25-18(21)10-11-20-19(22)17-9-8-14(26-17)12-24-16-7-5-4-6-15(16)23-3/h4-9,13H,10-12H2,1-3H3,(H,20,22) |
| InChIKey | NTMBWKRZNCTQBM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |