C24H24N2O4 — CID 55791961
N-(3-indol-1-ylpropyl)-5-[(2-methoxyphenoxy)methyl]furan-2-carboxamide (PubChem CID 55791961) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-(3-indol-1-ylpropyl)-5-[(2-methoxyphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(3-indol-1-ylpropyl)-5-[(2-methoxyphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55791961 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-(3-indol-1-ylpropyl)-5-[(2-methoxyphenoxy)methyl]furan-2-carboxamide |
| SMILES | COc1ccccc1OCc1ccc(C(=O)NCCCn2ccc3ccccc32)o1 |
| InChI | InChI=1S/C24H24N2O4/c1-28-21-9-4-5-10-22(21)29-17-19-11-12-23(30-19)24(27)25-14-6-15-26-16-13-18-7-2-3-8-20(18)26/h2-5,7-13,16H,6,14-15,17H2,1H3,(H,25,27) |
| InChIKey | MPAJYHAFVROUPV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|