C21H24N2O3 — CID 25343089
N-(3-indol-1-ylpropyl)-3,5-dimethoxy-4-methylbenzamide (PubChem CID 25343089) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-(3-indol-1-ylpropyl)-3,5-dimethoxy-4-methylbenzamide.
| Compound Name | N-(3-indol-1-ylpropyl)-3,5-dimethoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 25343089 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-(3-indol-1-ylpropyl)-3,5-dimethoxy-4-methylbenzamide |
| SMILES | COc1cc(C(=O)NCCCn2ccc3ccccc32)cc(OC)c1C |
| InChI | InChI=1S/C21H24N2O3/c1-15-19(25-2)13-17(14-20(15)26-3)21(24)22-10-6-11-23-12-9-16-7-4-5-8-18(16)23/h4-5,7-9,12-14H,6,10-11H2,1-3H3,(H,22,24) |
| InChIKey | OKTMPCMIFKGESJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|