C20H23N3O4 — CID 90556292
3,4,5-trimethoxy-N-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)benzamide (PubChem CID 90556292) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 90556292 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)benzamide |
| SMILES | COc1cc(C(=O)NCCCn2ccc3cccnc32)cc(OC)c1OC |
| InChI | InChI=1S/C20H23N3O4/c1-25-16-12-15(13-17(26-2)18(16)27-3)20(24)22-9-5-10-23-11-7-14-6-4-8-21-19(14)23/h4,6-8,11-13H,5,9-10H2,1-3H3,(H,22,24) |
| InChIKey | BKANHDUFPVTFPL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|