C16H21N3O4 — CID 37394118
3,4,5-trimethoxy-N-(3-pyrazol-1-ylpropyl)benzamide (PubChem CID 37394118) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(3-pyrazol-1-ylpropyl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(3-pyrazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 37394118 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-(3-pyrazol-1-ylpropyl)benzamide |
| SMILES | COc1cc(C(=O)NCCCn2cccn2)cc(OC)c1OC |
| InChI | InChI=1S/C16H21N3O4/c1-21-13-10-12(11-14(22-2)15(13)23-3)16(20)17-6-4-8-19-9-5-7-18-19/h5,7,9-11H,4,6,8H2,1-3H3,(H,17,20) |
| InChIKey | PUQWBSIPAPGBGD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|