C19H26N4O5 — CID 37394425
3,4,5-trimethoxy-N-[(2R)-1-oxo-1-(3-pyrazol-1-ylpropylamino)propan-2-yl]benzamide (PubChem CID 37394425) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(2R)-1-oxo-1-(3-pyrazol-1-ylpropylamino)propan-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(2R)-1-oxo-1-(3-pyrazol-1-ylpropylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 37394425 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(2R)-1-oxo-1-(3-pyrazol-1-ylpropylamino)propan-2-yl]benzamide |
| SMILES | COc1cc(C(=O)N[C@H](C)C(=O)NCCCn2cccn2)cc(OC)c1OC |
| InChI | InChI=1S/C19H26N4O5/c1-13(18(24)20-7-5-9-23-10-6-8-21-23)22-19(25)14-11-15(26-2)17(28-4)16(12-14)27-3/h6,8,10-13H,5,7,9H2,1-4H3,(H,20,24)(H,22,25)/t13-/m1/s1 |
| InChIKey | YHDAXZYVZOJBPE-CYBMUJFWSA-N |
| XLogP | 1.23 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|