C23H31N3O5 — CID 43008482
3,4,5-trimethoxy-N-[1-[3-(N-methylanilino)propylamino]-1-oxopropan-2-yl]benzamide (PubChem CID 43008482) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[1-[3-(N-methylanilino)propylamino]-1-oxopropan-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[1-[3-(N-methylanilino)propylamino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 43008482 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 3,4,5-trimethoxy-N-[1-[3-(N-methylanilino)propylamino]-1-oxopropan-2-yl]benzamide |
| SMILES | COc1cc(C(=O)NC(C)C(=O)NCCCN(C)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H31N3O5/c1-16(22(27)24-12-9-13-26(2)18-10-7-6-8-11-18)25-23(28)17-14-19(29-3)21(31-5)20(15-17)30-4/h6-8,10-11,14-16H,9,12-13H2,1-5H3,(H,24,27)(H,25,28) |
| InChIKey | KEEJDDMWGYUPIS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|