C20H25N5O6 — CID 3054253
N-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl]-3,4,5-trimethoxybenzamide (PubChem CID 3054253) has the molecular formula C20H25N5O6 and a molecular weight of 431.45 g/mol. Its IUPAC name is N-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3054253 |
| Molecular Formula | C20H25N5O6 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | N-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCCn2cnc3c2c(=O)n(C)c(=O)n3C)cc(OC)c1OC |
| InChI | InChI=1S/C20H25N5O6/c1-23-17-15(19(27)24(2)20(23)28)25(11-22-17)8-6-7-21-18(26)12-9-13(29-3)16(31-5)14(10-12)30-4/h9-11H,6-8H2,1-5H3,(H,21,26) |
| InChIKey | NYQNDZXHHNFPLO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|