C30H34N4O12 — CID 110176709
[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-(3,4,5-trimethoxybenzoyl)oxypropyl] 3,4,5-trimethoxybenzoate (PubChem CID 110176709) has the molecular formula C30H34N4O12 and a molecular weight of 642.62 g/mol. Its IUPAC name is [3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-(3,4,5-trimethoxybenzoyl)oxypropyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-(3,4,5-trimethoxybenzoyl)oxypropyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 110176709 |
| Molecular Formula | C30H34N4O12 |
| Molecular Weight | 642.62 g/mol |
| Exact Mass | 642.22 |
| IUPAC Name | [3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-(3,4,5-trimethoxybenzoyl)oxypropyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(Cn2cnc3c2c(=O)n(C)c(=O)n3C)OC(=O)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H34N4O12/c1-32-26-23(27(35)33(2)30(32)38)34(15-31-26)13-18(46-29(37)17-11-21(41-5)25(44-8)22(12-17)42-6)14-45-28(36)16-9-19(39-3)24(43-7)20(10-16)40-4/h9-12,15,18H,13-14H2,1-8H3 |
| InChIKey | XLVLVOWPRGHUHO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 169.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.62 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |