C13H18HgN4O5 — CID 101071306
CID 101071306 (PubChem CID 101071306) has the molecular formula C13H18HgN4O5 and a molecular weight of 510.90 g/mol.
| Compound Name | CID 101071306 |
|---|---|
| PubChem CID | 101071306 |
| Molecular Formula | C13H18HgN4O5 |
| Molecular Weight | 510.90 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | — |
| SMILES | CC(=O)[O-].[CH2]C(Cn1cnc2c1c(=O)n(C)c(=O)n2C)OC.[Hg+] |
| InChI | InChI=1S/C11H15N4O3.C2H4O2.Hg/c1-7(18-4)5-15-6-12-9-8(15)10(16)14(3)11(17)13(9)2;1-2(3)4;/h6-7H,1,5H2,2-4H3;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | MRYXJPOEMXBKDQ-UHFFFAOYSA-M |
| XLogP | -1.96 |
| TPSA | 111.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.90 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|