C18H22N8O7 — CID 175666286
7-(2,2-dihydroxyethyl)-1,3-dimethylpurine-2,6-dione;2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetaldehyde (PubChem CID 175666286) has the molecular formula C18H22N8O7 and a molecular weight of 462.42 g/mol. Its IUPAC name is 7-(2,2-dihydroxyethyl)-1,3-dimethylpurine-2,6-dione;2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetaldehyde.
| Compound Name | 7-(2,2-dihydroxyethyl)-1,3-dimethylpurine-2,6-dione;2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetaldehyde |
|---|---|
| PubChem CID | 175666286 |
| Molecular Formula | C18H22N8O7 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 7-(2,2-dihydroxyethyl)-1,3-dimethylpurine-2,6-dione;2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetaldehyde |
| SMILES | Cn1c(=O)c2c(ncn2CC(O)O)n(C)c1=O.Cn1c(=O)c2c(ncn2CC=O)n(C)c1=O |
| InChI | InChI=1S/C9H12N4O4.C9H10N4O3/c1-11-7-6(8(16)12(2)9(11)17)13(4-10-7)3-5(14)15;1-11-7-6(8(15)12(2)9(11)16)13(3-4-14)5-10-7/h4-5,14-15H,3H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | UTTVXKVWKSMWGQ-UHFFFAOYSA-N |
| XLogP | -3.62 |
| TPSA | 181.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|