C10H13ClN4O3 — CID 70482858
7-(3-chloro-3-hydroxypropyl)-1,3-dimethylpurine-2,6-dione (PubChem CID 70482858) has the molecular formula C10H13ClN4O3 and a molecular weight of 272.69 g/mol. Its IUPAC name is 7-(3-chloro-3-hydroxypropyl)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-(3-chloro-3-hydroxypropyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 70482858 |
| Molecular Formula | C10H13ClN4O3 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 7-(3-chloro-3-hydroxypropyl)-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCC(O)Cl)n(C)c1=O |
| InChI | InChI=1S/C10H13ClN4O3/c1-13-8-7(9(17)14(2)10(13)18)15(5-12-8)4-3-6(11)16/h5-6,16H,3-4H2,1-2H3 |
| InChIKey | NKZKUPXRPCRCDR-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|