C13H20N6O2 — CID 3294503
3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N'-propan-2-ylpropanimidamide (PubChem CID 3294503) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N'-propan-2-ylpropanimidamide.
| Compound Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N'-propan-2-ylpropanimidamide |
|---|---|
| PubChem CID | 3294503 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N'-propan-2-ylpropanimidamide |
| SMILES | CC(C)/N=C(\N)CCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H20N6O2/c1-8(2)16-9(14)5-6-19-7-15-11-10(19)12(20)18(4)13(21)17(11)3/h7-8H,5-6H2,1-4H3,(H2,14,16) |
| InChIKey | IJPQVCAFLRFYKM-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|