C8H11N5O2 — CID 22105142
7-(aminomethyl)-1,3-dimethylpurine-2,6-dione (PubChem CID 22105142) has the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. Its IUPAC name is 7-(aminomethyl)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-(aminomethyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 22105142 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 7-(aminomethyl)-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CN)n(C)c1=O |
| InChI | InChI=1S/C8H11N5O2/c1-11-6-5(13(3-9)4-10-6)7(14)12(2)8(11)15/h4H,3,9H2,1-2H3 |
| InChIKey | ZUAJGMLBWVGZCX-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |