C21H28N8O6 — CID 121334074
7-[2-[3-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethoxy]propoxy]ethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 121334074) has the molecular formula C21H28N8O6 and a molecular weight of 488.51 g/mol. Its IUPAC name is 7-[2-[3-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethoxy]propoxy]ethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-[3-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethoxy]propoxy]ethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 121334074 |
| Molecular Formula | C21H28N8O6 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 7-[2-[3-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethoxy]propoxy]ethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCOCCCOCCn2cnc3c2c(=O)n(C)c(=O)n3C)n(C)c1=O |
| InChI | InChI=1S/C21H28N8O6/c1-24-16-14(18(30)26(3)20(24)32)28(12-22-16)6-10-34-8-5-9-35-11-7-29-13-23-17-15(29)19(31)27(4)21(33)25(17)2/h12-13H,5-11H2,1-4H3 |
| InChIKey | WPOQWAGLCGGLSY-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 142.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|