C14H17F6N4O3P — CID 57129559
7-[2-[bis(2,2,2-trifluoroethyl)phosphanylmethoxy]ethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 57129559) has the molecular formula C14H17F6N4O3P and a molecular weight of 434.28 g/mol. Its IUPAC name is 7-[2-[bis(2,2,2-trifluoroethyl)phosphanylmethoxy]ethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-[bis(2,2,2-trifluoroethyl)phosphanylmethoxy]ethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 57129559 |
| Molecular Formula | C14H17F6N4O3P |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 7-[2-[bis(2,2,2-trifluoroethyl)phosphanylmethoxy]ethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCOCP(CC(F)(F)F)CC(F)(F)F)n(C)c1=O |
| InChI | InChI=1S/C14H17F6N4O3P/c1-22-10-9(11(25)23(2)12(22)26)24(7-21-10)3-4-27-8-28(5-13(15,16)17)6-14(18,19)20/h7H,3-6,8H2,1-2H3 |
| InChIKey | NYFISASSZFLCKP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|