C11H18ClN5O3 — CID 110180579
2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethoxy]ethylazanium chloride (PubChem CID 110180579) has the molecular formula C11H18ClN5O3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethoxy]ethylazanium chloride.
| Compound Name | 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethoxy]ethylazanium chloride |
|---|---|
| PubChem CID | 110180579 |
| Molecular Formula | C11H18ClN5O3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethoxy]ethylazanium chloride |
| SMILES | Cn1c(=O)c2c(ncn2CCOCC[NH3+])n(C)c1=O.[Cl-] |
| InChI | InChI=1S/C11H17N5O3.ClH/c1-14-9-8(10(17)15(2)11(14)18)16(7-13-9)4-6-19-5-3-12;/h7H,3-6,12H2,1-2H3;1H |
| InChIKey | MOOZCSRSQABSOO-UHFFFAOYSA-N |
| XLogP | -5.30 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|