C18H22N4O4 — CID 17435767
1,3-dimethyl-7-[2-(4-propoxyphenoxy)ethyl]purine-2,6-dione (PubChem CID 17435767) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-(4-propoxyphenoxy)ethyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[2-(4-propoxyphenoxy)ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 17435767 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1,3-dimethyl-7-[2-(4-propoxyphenoxy)ethyl]purine-2,6-dione |
| SMILES | CCCOc1ccc(OCCn2cnc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C18H22N4O4/c1-4-10-25-13-5-7-14(8-6-13)26-11-9-22-12-19-16-15(22)17(23)21(3)18(24)20(16)2/h5-8,12H,4,9-11H2,1-3H3 |
| InChIKey | FRPFPUDCVDUDTJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |