C15H22N4O5 — CID 95631875
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl (3S)-3-hydroxyhexanoate (PubChem CID 95631875) has the molecular formula C15H22N4O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl (3S)-3-hydroxyhexanoate.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl (3S)-3-hydroxyhexanoate |
|---|---|
| PubChem CID | 95631875 |
| Molecular Formula | C15H22N4O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl (3S)-3-hydroxyhexanoate |
| SMILES | CCC[C@H](O)CC(=O)OCCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C15H22N4O5/c1-4-5-10(20)8-11(21)24-7-6-19-9-16-13-12(19)14(22)18(3)15(23)17(13)2/h9-10,20H,4-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | YWDGQZKHFGGFCV-JTQLQIEISA-N |
| XLogP | -0.47 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |