C17H16Cl2N4O4 — CID 4879045
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-(2,6-dichlorophenyl)acetate (PubChem CID 4879045) has the molecular formula C17H16Cl2N4O4 and a molecular weight of 411.25 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-(2,6-dichlorophenyl)acetate.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-(2,6-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 4879045 |
| Molecular Formula | C17H16Cl2N4O4 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-(2,6-dichlorophenyl)acetate |
| SMILES | Cn1c(=O)c2c(ncn2CCOC(=O)Cc2c(Cl)cccc2Cl)n(C)c1=O |
| InChI | InChI=1S/C17H16Cl2N4O4/c1-21-15-14(16(25)22(2)17(21)26)23(9-20-15)6-7-27-13(24)8-10-11(18)4-3-5-12(10)19/h3-5,9H,6-8H2,1-2H3 |
| InChIKey | UNTNQICGSCVUFM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |