C17H18N4O6 — CID 55356166
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-hydroxy-3-methoxybenzoate (PubChem CID 55356166) has the molecular formula C17H18N4O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-hydroxy-3-methoxybenzoate.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 55356166 |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-hydroxy-3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCCn2cnc3c2c(=O)n(C)c(=O)n3C)c1O |
| InChI | InChI=1S/C17H18N4O6/c1-19-14-12(15(23)20(2)17(19)25)21(9-18-14)7-8-27-16(24)10-5-4-6-11(26-3)13(10)22/h4-6,9,22H,7-8H2,1-3H3 |
| InChIKey | KPMMOKDVHAPWOQ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |