C25H21N5O5 — CID 35486402
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-(5-phenyl-1,3-oxazol-2-yl)benzoate (PubChem CID 35486402) has the molecular formula C25H21N5O5 and a molecular weight of 471.47 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-(5-phenyl-1,3-oxazol-2-yl)benzoate.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-(5-phenyl-1,3-oxazol-2-yl)benzoate |
|---|---|
| PubChem CID | 35486402 |
| Molecular Formula | C25H21N5O5 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-(5-phenyl-1,3-oxazol-2-yl)benzoate |
| SMILES | Cn1c(=O)c2c(ncn2CCOC(=O)c2ccccc2-c2ncc(-c3ccccc3)o2)n(C)c1=O |
| InChI | InChI=1S/C25H21N5O5/c1-28-21-20(23(31)29(2)25(28)33)30(15-27-21)12-13-34-24(32)18-11-7-6-10-17(18)22-26-14-19(35-22)16-8-4-3-5-9-16/h3-11,14-15H,12-13H2,1-2H3 |
| InChIKey | CUFJCEMLPWRKEW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 114.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |