C19H14N2O3 — CID 8510359
cyanomethyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate (PubChem CID 8510359) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is cyanomethyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate.
| Compound Name | cyanomethyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate |
|---|---|
| PubChem CID | 8510359 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | cyanomethyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate |
| SMILES | Cc1ccc(-c2cnc(-c3ccccc3C(=O)OCC#N)o2)cc1 |
| InChI | InChI=1S/C19H14N2O3/c1-13-6-8-14(9-7-13)17-12-21-18(24-17)15-4-2-3-5-16(15)19(22)23-11-10-20/h2-9,12H,11H2,1H3 |
| InChIKey | UENZXJQHURGECC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |