C23H24N2O4 — CID 8510393
[2-(butylamino)-2-oxoethyl] 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate (PubChem CID 8510393) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate |
|---|---|
| PubChem CID | 8510393 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate |
| SMILES | CCCCNC(=O)COC(=O)c1ccccc1-c1ncc(-c2ccc(C)cc2)o1 |
| InChI | InChI=1S/C23H24N2O4/c1-3-4-13-24-21(26)15-28-23(27)19-8-6-5-7-18(19)22-25-14-20(29-22)17-11-9-16(2)10-12-17/h5-12,14H,3-4,13,15H2,1-2H3,(H,24,26) |
| InChIKey | ZCLYVNNXLJOMBY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|