C26H23N3O4 — CID 55405796
N'-[2-(2,5-dimethylphenoxy)acetyl]-2-(5-phenyl-1,3-oxazol-2-yl)benzohydrazide (PubChem CID 55405796) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenoxy)acetyl]-2-(5-phenyl-1,3-oxazol-2-yl)benzohydrazide.
| Compound Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-2-(5-phenyl-1,3-oxazol-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 55405796 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-2-(5-phenyl-1,3-oxazol-2-yl)benzohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)c2ccccc2-c2ncc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C26H23N3O4/c1-17-12-13-18(2)22(14-17)32-16-24(30)28-29-25(31)20-10-6-7-11-21(20)26-27-15-23(33-26)19-8-4-3-5-9-19/h3-15H,16H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | DYKYNCWGTHXPFP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|