C18H20N4O5 — CID 110180937
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 3-hydroxy-2-phenylpropanoate (PubChem CID 110180937) has the molecular formula C18H20N4O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 3-hydroxy-2-phenylpropanoate.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 110180937 |
| Molecular Formula | C18H20N4O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 3-hydroxy-2-phenylpropanoate |
| SMILES | Cn1c(=O)c2c(ncn2CCOC(=O)C(CO)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C18H20N4O5/c1-20-15-14(16(24)21(2)18(20)26)22(11-19-15)8-9-27-17(25)13(10-23)12-6-4-3-5-7-12/h3-7,11,13,23H,8-10H2,1-2H3 |
| InChIKey | BGBPPJFSIIRYAE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |