C17H18N4O3 — CID 131844359
1,3-dimethyl-7-(2-phenylbutanoyl)purine-2,6-dione (PubChem CID 131844359) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1,3-dimethyl-7-(2-phenylbutanoyl)purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(2-phenylbutanoyl)purine-2,6-dione |
|---|---|
| PubChem CID | 131844359 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1,3-dimethyl-7-(2-phenylbutanoyl)purine-2,6-dione |
| SMILES | CCC(C(=O)n1cnc2c1c(=O)n(C)c(=O)n2C)c1ccccc1 |
| InChI | InChI=1S/C17H18N4O3/c1-4-12(11-8-6-5-7-9-11)15(22)21-10-18-14-13(21)16(23)20(3)17(24)19(14)2/h5-10,12H,4H2,1-3H3 |
| InChIKey | DLZUBFGLRBPONI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |