C17H22ClN5O3 — CID 110174112
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl-(2-hydroxy-2-phenylethyl)azanium chloride (PubChem CID 110174112) has the molecular formula C17H22ClN5O3 and a molecular weight of 379.85 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl-(2-hydroxy-2-phenylethyl)azanium chloride.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl-(2-hydroxy-2-phenylethyl)azanium chloride |
|---|---|
| PubChem CID | 110174112 |
| Molecular Formula | C17H22ClN5O3 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl-(2-hydroxy-2-phenylethyl)azanium chloride |
| SMILES | Cn1c(=O)c2c(ncn2CC[NH2+]CC(O)c2ccccc2)n(C)c1=O.[Cl-] |
| InChI | InChI=1S/C17H21N5O3.ClH/c1-20-15-14(16(24)21(2)17(20)25)22(11-19-15)9-8-18-10-13(23)12-6-4-3-5-7-12;/h3-7,11,13,18,23H,8-10H2,1-2H3;1H |
| InChIKey | AKZFTYHEAAPWQI-UHFFFAOYSA-N |
| XLogP | -4.27 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|