C26H36BrN5O3 — CID 110176278
3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl-(4-hydroxy-4-phenylbutan-2-yl)-bis(prop-2-enyl)azanium bromide (PubChem CID 110176278) has the molecular formula C26H36BrN5O3 and a molecular weight of 546.51 g/mol. Its IUPAC name is 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl-(4-hydroxy-4-phenylbutan-2-yl)-bis(prop-2-enyl)azanium bromide.
| Compound Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl-(4-hydroxy-4-phenylbutan-2-yl)-bis(prop-2-enyl)azanium bromide |
|---|---|
| PubChem CID | 110176278 |
| Molecular Formula | C26H36BrN5O3 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl-(4-hydroxy-4-phenylbutan-2-yl)-bis(prop-2-enyl)azanium bromide |
| SMILES | C=CC[N+](CC=C)(CCCn1cnc2c1c(=O)n(C)c(=O)n2C)C(C)CC(O)c1ccccc1.[Br-] |
| InChI | InChI=1S/C26H36N5O3.BrH/c1-6-15-31(16-7-2,20(3)18-22(32)21-12-9-8-10-13-21)17-11-14-30-19-27-24-23(30)25(33)29(5)26(34)28(24)4;/h6-10,12-13,19-20,22,32H,1-2,11,14-18H2,3-5H3;1H/q+1;/p-1 |
| InChIKey | FJEQZMZNFBINIH-UHFFFAOYSA-M |
| XLogP | -0.47 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|