C20H27N5O2 — CID 110175748
7-[3-[benzyl(propan-2-yl)amino]propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 110175748) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 7-[3-[benzyl(propan-2-yl)amino]propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[3-[benzyl(propan-2-yl)amino]propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 110175748 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 7-[3-[benzyl(propan-2-yl)amino]propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CC(C)N(CCCn1cnc2c1c(=O)n(C)c(=O)n2C)Cc1ccccc1 |
| InChI | InChI=1S/C20H27N5O2/c1-15(2)24(13-16-9-6-5-7-10-16)11-8-12-25-14-21-18-17(25)19(26)23(4)20(27)22(18)3/h5-7,9-10,14-15H,8,11-13H2,1-4H3 |
| InChIKey | SRWDVSWWDRNJRM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |