C16H20N5O2+ — CID 6969275
benzyl-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl]-methylazanium (PubChem CID 6969275) has the molecular formula C16H20N5O2+ and a molecular weight of 314.37 g/mol. Its IUPAC name is benzyl-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl]-methylazanium.
| Compound Name | benzyl-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 6969275 |
| Molecular Formula | C16H20N5O2+ |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | benzyl-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl]-methylazanium |
| SMILES | Cn1c(=O)c2c(ncn2C[NH+](C)Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C16H19N5O2/c1-18(9-12-7-5-4-6-8-12)11-21-10-17-14-13(21)15(22)20(3)16(23)19(14)2/h4-8,10H,9,11H2,1-3H3/p+1 |
| InChIKey | BWCVNCIMWSAMKA-UHFFFAOYSA-O |
| XLogP | -0.89 |
| TPSA | 66.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |