C19H26N5O2+ — CID 110175962
benzyl-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl]-dimethylazanium (PubChem CID 110175962) has the molecular formula C19H26N5O2+ and a molecular weight of 356.45 g/mol. Its IUPAC name is benzyl-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl]-dimethylazanium.
| Compound Name | benzyl-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 110175962 |
| Molecular Formula | C19H26N5O2+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | benzyl-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl]-dimethylazanium |
| SMILES | Cn1c(=O)c2c(ncn2CCC[N+](C)(C)Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C19H26N5O2/c1-21-17-16(18(25)22(2)19(21)26)23(14-20-17)11-8-12-24(3,4)13-15-9-6-5-7-10-15/h5-7,9-10,14H,8,11-13H2,1-4H3/q+1 |
| InChIKey | HAWUFZSXPPWHNO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|