C21H27N5O2 — CID 110175758
7-[3-[benzyl-[(E)-but-2-enyl]amino]propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 110175758) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 7-[3-[benzyl-[(E)-but-2-enyl]amino]propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[3-[benzyl-[(E)-but-2-enyl]amino]propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 110175758 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 7-[3-[benzyl-[(E)-but-2-enyl]amino]propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | C/C=C/CN(CCCn1cnc2c1c(=O)n(C)c(=O)n2C)Cc1ccccc1 |
| InChI | InChI=1S/C21H27N5O2/c1-4-5-12-25(15-17-10-7-6-8-11-17)13-9-14-26-16-22-19-18(26)20(27)24(3)21(28)23(19)2/h4-8,10-11,16H,9,12-15H2,1-3H3/b5-4+ |
| InChIKey | ZOWXSXDBQCMUCM-SNAWJCMRSA-N |
| XLogP | 1.90 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|