C18H24N5O2+ — CID 10434822
benzyl-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]-dimethylazanium (PubChem CID 10434822) has the molecular formula C18H24N5O2+ and a molecular weight of 342.42 g/mol. Its IUPAC name is benzyl-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]-dimethylazanium.
| Compound Name | benzyl-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 10434822 |
| Molecular Formula | C18H24N5O2+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | benzyl-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]-dimethylazanium |
| SMILES | Cn1c(=O)c2c(ncn2CC[N+](C)(C)Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C18H24N5O2/c1-20-16-15(17(24)21(2)18(20)25)22(13-19-16)10-11-23(3,4)12-14-8-6-5-7-9-14/h5-9,13H,10-12H2,1-4H3/q+1 |
| InChIKey | PUBRBGMVRQFUNI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|