C32H54N10O4+2 — CID 24833043
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl-[10-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl-dimethylazaniumyl]decyl]-dimethylazanium (PubChem CID 24833043) has the molecular formula C32H54N10O4+2 and a molecular weight of 642.85 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl-[10-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl-dimethylazaniumyl]decyl]-dimethylazanium.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl-[10-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl-dimethylazaniumyl]decyl]-dimethylazanium |
|---|---|
| PubChem CID | 24833043 |
| Molecular Formula | C32H54N10O4+2 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 642.43 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl-[10-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl-dimethylazaniumyl]decyl]-dimethylazanium |
| SMILES | Cn1c(=O)c2c(ncn2CC[N+](C)(C)CCCCCCCCCC[N+](C)(C)CCn2cnc3c2c(=O)n(C)c(=O)n3C)n(C)c1=O |
| InChI | InChI=1S/C32H54N10O4/c1-35-27-25(29(43)37(3)31(35)45)39(23-33-27)17-21-41(5,6)19-15-13-11-9-10-12-14-16-20-42(7,8)22-18-40-24-34-28-26(40)30(44)38(4)32(46)36(28)2/h23-24H,9-22H2,1-8H3/q+2 |
| InChIKey | JVBROSKGSZPCOY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 123.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|