C14H24N5O2+ — CID 110175968
[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-methylpropyl]-trimethylazanium (PubChem CID 110175968) has the molecular formula C14H24N5O2+ and a molecular weight of 294.38 g/mol. Its IUPAC name is [3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-methylpropyl]-trimethylazanium.
| Compound Name | [3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-methylpropyl]-trimethylazanium |
|---|---|
| PubChem CID | 110175968 |
| Molecular Formula | C14H24N5O2+ |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | [3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-methylpropyl]-trimethylazanium |
| SMILES | CC(Cn1cnc2c1c(=O)n(C)c(=O)n2C)C[N+](C)(C)C |
| InChI | InChI=1S/C14H24N5O2/c1-10(8-19(4,5)6)7-18-9-15-12-11(18)13(20)17(3)14(21)16(12)2/h9-10H,7-8H2,1-6H3/q+1 |
| InChIKey | HTWRRZDXICJBJM-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|