C11H16N4O4 — CID 140979198
7-(2,2-dimethoxyethyl)-1,3-dimethylpurine-2,6-dione (PubChem CID 140979198) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 7-(2,2-dimethoxyethyl)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-(2,2-dimethoxyethyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 140979198 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 7-(2,2-dimethoxyethyl)-1,3-dimethylpurine-2,6-dione |
| SMILES | COC(Cn1cnc2c1c(=O)n(C)c(=O)n2C)OC |
| InChI | InChI=1S/C11H16N4O4/c1-13-9-8(10(16)14(2)11(13)17)15(6-12-9)5-7(18-3)19-4/h6-7H,5H2,1-4H3 |
| InChIKey | WUIMHDSPSQXXIW-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|