C9H14ClN5O2 — CID 2965224
7-(2-aminoethyl)-1,3-dimethylpurine-2,6-dione;hydrochloride (PubChem CID 2965224) has the molecular formula C9H14ClN5O2 and a molecular weight of 259.70 g/mol. Its IUPAC name is 7-(2-aminoethyl)-1,3-dimethylpurine-2,6-dione;hydrochloride.
| Compound Name | 7-(2-aminoethyl)-1,3-dimethylpurine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 2965224 |
| Molecular Formula | C9H14ClN5O2 |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 7-(2-aminoethyl)-1,3-dimethylpurine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)c2c(ncn2CCN)n(C)c1=O |
| InChI | InChI=1S/C9H13N5O2.ClH/c1-12-7-6(8(15)13(2)9(12)16)14(4-3-10)5-11-7;/h5H,3-4,10H2,1-2H3;1H |
| InChIKey | POOHRJCIRTYEQE-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |