C14H13ClN4O2 — CID 706880
7-[(4-chlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 706880) has the molecular formula C14H13ClN4O2 and a molecular weight of 304.74 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 706880 |
| Molecular Formula | C14H13ClN4O2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2Cc2ccc(Cl)cc2)n(C)c1=O |
| InChI | InChI=1S/C14H13ClN4O2/c1-17-12-11(13(20)18(2)14(17)21)19(8-16-12)7-9-3-5-10(15)6-4-9/h3-6,8H,7H2,1-2H3 |
| InChIKey | OWGPGVCFGYYWGB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |