C14H13FN4OS — CID 155704861
7-[(4-fluorophenyl)methyl]-1,3-dimethyl-6-sulfanylidenepurin-2-one (PubChem CID 155704861) has the molecular formula C14H13FN4OS and a molecular weight of 304.35 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-1,3-dimethyl-6-sulfanylidenepurin-2-one.
| Compound Name | 7-[(4-fluorophenyl)methyl]-1,3-dimethyl-6-sulfanylidenepurin-2-one |
|---|---|
| PubChem CID | 155704861 |
| Molecular Formula | C14H13FN4OS |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-1,3-dimethyl-6-sulfanylidenepurin-2-one |
| SMILES | Cn1c(=S)c2c(ncn2Cc2ccc(F)cc2)n(C)c1=O |
| InChI | InChI=1S/C14H13FN4OS/c1-17-12-11(13(21)18(2)14(17)20)19(8-16-12)7-9-3-5-10(15)6-4-9/h3-6,8H,7H2,1-2H3 |
| InChIKey | CGEVOABTXISKQC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 44.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|