C18H17N5O3S — CID 164804714
2-[3-(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)propyl]isoindole-1,3-dione (PubChem CID 164804714) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is 2-[3-(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 164804714 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-[3-(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)propyl]isoindole-1,3-dione |
| SMILES | Cn1c(=S)c2c(ncn2CCCN2C(=O)c3ccccc3C2=O)n(C)c1=O |
| InChI | InChI=1S/C18H17N5O3S/c1-20-14-13(17(27)21(2)18(20)26)22(10-19-14)8-5-9-23-15(24)11-6-3-4-7-12(11)16(23)25/h3-4,6-7,10H,5,8-9H2,1-2H3 |
| InChIKey | PEYPJGWZKVXOKF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|