C17H19BrN6O4S2 — CID 164804738
1-(3-bromophenyl)sulfonyl-3-[3-(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)propyl]urea (PubChem CID 164804738) has the molecular formula C17H19BrN6O4S2 and a molecular weight of 515.42 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfonyl-3-[3-(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)propyl]urea.
| Compound Name | 1-(3-bromophenyl)sulfonyl-3-[3-(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)propyl]urea |
|---|---|
| PubChem CID | 164804738 |
| Molecular Formula | C17H19BrN6O4S2 |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | 1-(3-bromophenyl)sulfonyl-3-[3-(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)propyl]urea |
| SMILES | Cn1c(=S)c2c(ncn2CCCNC(=O)NS(=O)(=O)c2cccc(Br)c2)n(C)c1=O |
| InChI | InChI=1S/C17H19BrN6O4S2/c1-22-14-13(15(29)23(2)17(22)26)24(10-20-14)8-4-7-19-16(25)21-30(27,28)12-6-3-5-11(18)9-12/h3,5-6,9-10H,4,7-8H2,1-2H3,(H2,19,21,25) |
| InChIKey | LPTSEJQNNVTLRU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|