C11H15BrN2O4S — CID 26543777
2-[(3-bromophenyl)sulfonylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 26543777) has the molecular formula C11H15BrN2O4S and a molecular weight of 351.22 g/mol. Its IUPAC name is 2-[(3-bromophenyl)sulfonylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(3-bromophenyl)sulfonylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 26543777 |
| Molecular Formula | C11H15BrN2O4S |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 2-[(3-bromophenyl)sulfonylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H15BrN2O4S/c1-18-6-5-13-11(15)8-14-19(16,17)10-4-2-3-9(12)7-10/h2-4,7,14H,5-6,8H2,1H3,(H,13,15) |
| InChIKey | SBCQSTMDDWUFCD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|