C9H13BrN2O4S2 — CID 113225778
2-[(3-bromothiophen-2-yl)sulfonylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 113225778) has the molecular formula C9H13BrN2O4S2 and a molecular weight of 357.25 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)sulfonylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 113225778 |
| Molecular Formula | C9H13BrN2O4S2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 355.95 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNS(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C9H13BrN2O4S2/c1-16-4-3-11-8(13)6-12-18(14,15)9-7(10)2-5-17-9/h2,5,12H,3-4,6H2,1H3,(H,11,13) |
| InChIKey | BYQPUVHXPISAFF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|