C6H7BrN2O2S3 — CID 61457900
2-[(3-bromothiophen-2-yl)sulfonylamino]ethanethioamide (PubChem CID 61457900) has the molecular formula C6H7BrN2O2S3 and a molecular weight of 315.24 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)sulfonylamino]ethanethioamide.
| Compound Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]ethanethioamide |
|---|---|
| PubChem CID | 61457900 |
| Molecular Formula | C6H7BrN2O2S3 |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 313.89 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]ethanethioamide |
| SMILES | NC(=S)CNS(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C6H7BrN2O2S3/c7-4-1-2-13-6(4)14(10,11)9-3-5(8)12/h1-2,9H,3H2,(H2,8,12) |
| InChIKey | GVFKEGIKFYLMHW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|