C10H13BrN2O2S3 — CID 62957127
2-[(3-bromothiophen-2-yl)sulfonylamino]cyclopentane-1-carbothioamide (PubChem CID 62957127) has the molecular formula C10H13BrN2O2S3 and a molecular weight of 369.33 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)sulfonylamino]cyclopentane-1-carbothioamide.
| Compound Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 62957127 |
| Molecular Formula | C10H13BrN2O2S3 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 367.93 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]cyclopentane-1-carbothioamide |
| SMILES | NC(=S)C1CCCC1NS(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C10H13BrN2O2S3/c11-7-4-5-17-10(7)18(14,15)13-8-3-1-2-6(8)9(12)16/h4-6,8,13H,1-3H2,(H2,12,16) |
| InChIKey | NIPUWNXVFPNXBU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|