C12H18BrNO2S2 — CID 64916244
3-bromo-N-(3-ethyl-2-methylcyclopentyl)thiophene-2-sulfonamide (PubChem CID 64916244) has the molecular formula C12H18BrNO2S2 and a molecular weight of 352.32 g/mol. Its IUPAC name is 3-bromo-N-(3-ethyl-2-methylcyclopentyl)thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-(3-ethyl-2-methylcyclopentyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 64916244 |
| Molecular Formula | C12H18BrNO2S2 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 3-bromo-N-(3-ethyl-2-methylcyclopentyl)thiophene-2-sulfonamide |
| SMILES | CCC1CCC(NS(=O)(=O)c2sccc2Br)C1C |
| InChI | InChI=1S/C12H18BrNO2S2/c1-3-9-4-5-11(8(9)2)14-18(15,16)12-10(13)6-7-17-12/h6-9,11,14H,3-5H2,1-2H3 |
| InChIKey | ZVRKXGHSOSUCTJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |