C16H23NO3S — CID 64916419
4-acetyl-N-(3-ethyl-2-methylcyclopentyl)benzenesulfonamide (PubChem CID 64916419) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 4-acetyl-N-(3-ethyl-2-methylcyclopentyl)benzenesulfonamide.
| Compound Name | 4-acetyl-N-(3-ethyl-2-methylcyclopentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 64916419 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 4-acetyl-N-(3-ethyl-2-methylcyclopentyl)benzenesulfonamide |
| SMILES | CCC1CCC(NS(=O)(=O)c2ccc(C(C)=O)cc2)C1C |
| InChI | InChI=1S/C16H23NO3S/c1-4-13-7-10-16(11(13)2)17-21(19,20)15-8-5-14(6-9-15)12(3)18/h5-6,8-9,11,13,16-17H,4,7,10H2,1-3H3 |
| InChIKey | LYWBAPRDSPUGIX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |