C15H21NO4S — CID 64921123
3-[(3-ethyl-2-methylcyclopentyl)sulfamoyl]benzoic acid (PubChem CID 64921123) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 3-[(3-ethyl-2-methylcyclopentyl)sulfamoyl]benzoic acid.
| Compound Name | 3-[(3-ethyl-2-methylcyclopentyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 64921123 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3-[(3-ethyl-2-methylcyclopentyl)sulfamoyl]benzoic acid |
| SMILES | CCC1CCC(NS(=O)(=O)c2cccc(C(=O)O)c2)C1C |
| InChI | InChI=1S/C15H21NO4S/c1-3-11-7-8-14(10(11)2)16-21(19,20)13-6-4-5-12(9-13)15(17)18/h4-6,9-11,14,16H,3,7-8H2,1-2H3,(H,17,18) |
| InChIKey | UYFDFRCFMGDYSL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |